C26H31NO4 — CID 126090924
9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126090924) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126090924 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C26H31NO4/c1-5-9-16-14-17(15-22(30-3)26(16)31-4)23-24-18(10-7-12-20(24)28)27(6-2)19-11-8-13-21(29)25(19)23/h5,14-15,23H,1,6-13H2,2-4H3 |
| InChIKey | XODCEJVYVUJKCO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|