C37H39NO4 — CID 126077467
9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126077467) has the molecular formula C37H39NO4 and a molecular weight of 561.72 g/mol. Its IUPAC name is 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126077467 |
| Molecular Formula | C37H39NO4 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C37H39NO4/c1-4-12-25-21-27(22-33(41-6-3)37(25)42-23-26-15-9-14-24-13-7-8-16-28(24)26)34-35-29(17-10-19-31(35)39)38(5-2)30-18-11-20-32(40)36(30)34/h4,7-9,13-16,21-22,34H,1,5-6,10-12,17-20,23H2,2-3H3 |
| InChIKey | NFSHKEFPZFZKCD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|