C47H51NO4 — CID 126078260
9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126078260) has the molecular formula C47H51NO4 and a molecular weight of 693.93 g/mol. Its IUPAC name is 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126078260 |
| Molecular Formula | C47H51NO4 |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | 9-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C47H51NO4/c1-7-15-33-24-35(25-41(51-8-2)45(33)52-30-34-20-14-19-32-18-12-13-21-36(32)34)42-43-37(26-46(3,4)28-39(43)49)48(23-22-31-16-10-9-11-17-31)38-27-47(5,6)29-40(50)44(38)42/h7,9-14,16-21,24-25,42H,1,8,15,22-23,26-30H2,2-6H3 |
| InChIKey | SQLISBXMYUGELB-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|