C45H47NO4 — CID 126074297
10-benzyl-9-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126074297) has the molecular formula C45H47NO4 and a molecular weight of 665.87 g/mol. Its IUPAC name is 10-benzyl-9-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-benzyl-9-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126074297 |
| Molecular Formula | C45H47NO4 |
| Molecular Weight | 665.87 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | 10-benzyl-9-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C45H47NO4/c1-7-14-31-21-33(22-39(49-6)43(31)50-28-32-19-13-18-30-17-11-12-20-34(30)32)40-41-35(23-44(2,3)25-37(41)47)46(27-29-15-9-8-10-16-29)36-24-45(4,5)26-38(48)42(36)40/h7-13,15-22,40H,1,14,23-28H2,2-6H3 |
| InChIKey | RKBFBIDNDLNBFA-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.87 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|