C36H40ClNO6 — CID 126071995
2-[9-[4-[(3-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126071995) has the molecular formula C36H40ClNO6 and a molecular weight of 618.17 g/mol. Its IUPAC name is 2-[9-[4-[(3-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[4-[(3-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126071995 |
| Molecular Formula | C36H40ClNO6 |
| Molecular Weight | 618.17 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 2-[9-[4-[(3-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C36H40ClNO6/c1-7-9-22-13-23(14-29(43-6)34(22)44-20-21-10-8-11-24(37)12-21)31-32-25(15-35(2,3)17-27(32)39)38(19-30(41)42)26-16-36(4,5)18-28(40)33(26)31/h7-8,10-14,31H,1,9,15-20H2,2-6H3,(H,41,42) |
| InChIKey | JRXVHOAJBMVWSE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.17 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|