C38H45Cl2NO5 — CID 126079030
9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126079030) has the molecular formula C38H45Cl2NO5 and a molecular weight of 666.69 g/mol. Its IUPAC name is 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126079030 |
| Molecular Formula | C38H45Cl2NO5 |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C38H45Cl2NO5/c1-8-10-23-15-25(16-32(45-7)36(23)46-22-24-11-12-26(39)17-27(24)40)33-34-28(18-37(2,3)20-30(34)42)41(13-9-14-44-6)29-19-38(4,5)21-31(43)35(29)33/h8,11-12,15-17,33H,1,9-10,13-14,18-22H2,2-7H3 |
| InChIKey | KFMAGBIAQCOIPL-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|