C37H44FNO4 — CID 126078953
9-[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126078953) has the molecular formula C37H44FNO4 and a molecular weight of 585.76 g/mol. Its IUPAC name is 9-[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126078953 |
| Molecular Formula | C37H44FNO4 |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 9-[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C37H44FNO4/c1-8-11-24-16-25(17-31(42-7)35(24)43-22-23-12-10-13-26(38)15-23)32-33-27(18-36(3,4)20-29(33)40)39(14-9-2)28-19-37(5,6)21-30(41)34(28)32/h8,10,12-13,15-17,32H,1,9,11,14,18-22H2,2-7H3 |
| InChIKey | WBMBOLSTUKVJFO-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|