C42H46FNO4 — CID 126073833
10-benzyl-9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126073833) has the molecular formula C42H46FNO4 and a molecular weight of 647.83 g/mol. Its IUPAC name is 10-benzyl-9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-benzyl-9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126073833 |
| Molecular Formula | C42H46FNO4 |
| Molecular Weight | 647.83 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | 10-benzyl-9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C42H46FNO4/c1-7-13-29-19-30(20-36(47-8-2)40(29)48-26-28-16-12-17-31(43)18-28)37-38-32(21-41(3,4)23-34(38)45)44(25-27-14-10-9-11-15-27)33-22-42(5,6)24-35(46)39(33)37/h7,9-12,14-20,37H,1,8,13,21-26H2,2-6H3 |
| InChIKey | DSTKKOHVRYZFSE-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.83 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|