C33H34ClNO6 — CID 126079678
2-[9-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126079678) has the molecular formula C33H34ClNO6 and a molecular weight of 576.09 g/mol. Its IUPAC name is 2-[9-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126079678 |
| Molecular Formula | C33H34ClNO6 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[9-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(OCC)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C33H34ClNO6/c1-3-8-21-16-22(17-28(40-4-2)33(21)41-19-20-9-5-10-23(34)15-20)30-31-24(11-6-13-26(31)36)35(18-29(38)39)25-12-7-14-27(37)32(25)30/h3,5,9-10,15-17,30H,1,4,6-8,11-14,18-19H2,2H3,(H,38,39) |
| InChIKey | MBPXQBVEXWHPBG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|