C34H36ClNO6 — CID 126074735
3-[9-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126074735) has the molecular formula C34H36ClNO6 and a molecular weight of 590.12 g/mol. Its IUPAC name is 3-[9-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126074735 |
| Molecular Formula | C34H36ClNO6 |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 3-[9-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(OCC)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C34H36ClNO6/c1-3-9-21-18-23(19-29(41-4-2)34(21)42-20-22-10-5-6-11-24(22)35)31-32-25(12-7-14-27(32)37)36(17-16-30(39)40)26-13-8-15-28(38)33(26)31/h3,5-6,10-11,18-19,31H,1,4,7-9,12-17,20H2,2H3,(H,39,40) |
| InChIKey | IMHXCKJFNWUXPB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|