C35H39BrClNO6 — CID 126082348
3-[9-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126082348) has the molecular formula C35H39BrClNO6 and a molecular weight of 685.06 g/mol. Its IUPAC name is 3-[9-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126082348 |
| Molecular Formula | C35H39BrClNO6 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | 3-[9-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C35H39BrClNO6/c1-6-43-28-14-21(13-22(36)33(28)44-19-20-9-7-8-10-23(20)37)30-31-24(15-34(2,3)17-26(31)39)38(12-11-29(41)42)25-16-35(4,5)18-27(40)32(25)30/h7-10,13-14,30H,6,11-12,15-19H2,1-5H3,(H,41,42) |
| InChIKey | ZXQZDEPCJCSVOC-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |