C33H36BrNO6 — CID 4771972
2-[9-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 4771972) has the molecular formula C33H36BrNO6 and a molecular weight of 622.56 g/mol. Its IUPAC name is 2-[9-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 4771972 |
| Molecular Formula | C33H36BrNO6 |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | 2-[9-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C33H36BrNO6/c1-32(2)13-22-29(24(36)15-32)28(30-23(35(22)17-27(38)39)14-33(3,4)16-25(30)37)20-11-21(34)31(26(12-20)40-5)41-18-19-9-7-6-8-10-19/h6-12,28H,13-18H2,1-5H3,(H,38,39) |
| InChIKey | NKODVLSUFJVCJV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |