C32H33BrClNO5 — CID 4764314
2-[9-[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 4764314) has the molecular formula C32H33BrClNO5 and a molecular weight of 626.98 g/mol. Its IUPAC name is 2-[9-[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 4764314 |
| Molecular Formula | C32H33BrClNO5 |
| Molecular Weight | 626.98 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | 2-[9-[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C32H33BrClNO5/c1-31(2)12-22-29(24(36)14-31)28(30-23(35(22)16-27(38)39)13-32(3,4)15-25(30)37)19-7-10-26(21(33)11-19)40-17-18-5-8-20(34)9-6-18/h5-11,28H,12-17H2,1-4H3,(H,38,39) |
| InChIKey | KCGRYPPKRFTHSN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.98 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |