C34H36BrNO7 — CID 126072642
4-[[2-bromo-4-[10-(2-carboxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid (PubChem CID 126072642) has the molecular formula C34H36BrNO7 and a molecular weight of 650.57 g/mol. Its IUPAC name is 4-[[2-bromo-4-[10-(2-carboxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[10-(2-carboxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126072642 |
| Molecular Formula | C34H36BrNO7 |
| Molecular Weight | 650.57 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | 4-[[2-bromo-4-[10-(2-carboxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(OCc2ccc(C(=O)O)cc2)c(Br)c1 |
| InChI | InChI=1S/C34H36BrNO7/c1-33(2)14-23-30(25(37)16-33)29(31-24(36(23)12-11-28(39)40)15-34(3,4)17-26(31)38)21-9-10-27(22(35)13-21)43-18-19-5-7-20(8-6-19)32(41)42/h5-10,13,29H,11-12,14-18H2,1-4H3,(H,39,40)(H,41,42) |
| InChIKey | KRKUCFUKNNNAGC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |