C28H26BrNO5 — CID 126083804
4-[[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 126083804) has the molecular formula C28H26BrNO5 and a molecular weight of 536.42 g/mol. Its IUPAC name is 4-[[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126083804 |
| Molecular Formula | C28H26BrNO5 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 4-[[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2ccc(OCc3ccc(C(=O)O)cc3)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H26BrNO5/c1-30-20-4-2-6-22(31)26(20)25(27-21(30)5-3-7-23(27)32)18-12-13-24(19(29)14-18)35-15-16-8-10-17(11-9-16)28(33)34/h8-14,25H,2-7,15H2,1H3,(H,33,34) |
| InChIKey | DWQYIOWLZWVNIG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |