C29H29NO5 — CID 1290893
5-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-phenylmethoxybenzoic acid (PubChem CID 1290893) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 5-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-phenylmethoxybenzoic acid.
| Compound Name | 5-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 1290893 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 5-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-phenylmethoxybenzoic acid |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(OCc3ccccc3)c(C(=O)O)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H29NO5/c1-2-30-21-10-6-12-23(31)27(21)26(28-22(30)11-7-13-24(28)32)19-14-15-25(20(16-19)29(33)34)35-17-18-8-4-3-5-9-18/h3-5,8-9,14-16,26H,2,6-7,10-13,17H2,1H3,(H,33,34) |
| InChIKey | MAEBIQUTWYZPOX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |