C29H31NO3 — CID 1325913
10-ethyl-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 1325913) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is 10-ethyl-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-ethyl-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1325913 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 10-ethyl-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(OCc3ccc(C)cc3)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H31NO3/c1-3-30-23-6-4-8-25(31)28(23)27(29-24(30)7-5-9-26(29)32)21-14-16-22(17-15-21)33-18-20-12-10-19(2)11-13-20/h10-17,27H,3-9,18H2,1-2H3 |
| InChIKey | LCDNYASJCQHRDC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |