C31H33NO6 — CID 126078274
4-[[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 126078274) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126078274 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 4-[[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H33NO6/c1-3-32-22-7-5-9-24(33)29(22)28(30-23(32)8-6-10-25(30)34)21-15-16-26(27(17-21)37-4-2)38-18-19-11-13-20(14-12-19)31(35)36/h11-17,28H,3-10,18H2,1-2H3,(H,35,36) |
| InChIKey | SQWQSSRPDDDTBA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |