C29H30FNO4 — CID 1327114
9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 1327114) has the molecular formula C29H30FNO4 and a molecular weight of 475.56 g/mol. Its IUPAC name is 9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1327114 |
| Molecular Formula | C29H30FNO4 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 9-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-10-methyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(C)C3=C2C(=O)CCC3)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C29H30FNO4/c1-3-34-26-16-19(13-14-25(26)35-17-18-7-4-8-20(30)15-18)27-28-21(9-5-11-23(28)32)31(2)22-10-6-12-24(33)29(22)27/h4,7-8,13-16,27H,3,5-6,9-12,17H2,1-2H3 |
| InChIKey | WTUAZKMMAWHGOY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |