C26H30N2O3S — CID 110528207
4-(3-ethoxy-4-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528207) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 4-(3-ethoxy-4-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3-ethoxy-4-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528207 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4-(3-ethoxy-4-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CCCN1C(=S)NC(c2ccc(OCc3ccccc3)c(OCC)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C26H30N2O3S/c1-3-15-28-20-11-8-12-21(29)24(20)25(27-26(28)32)19-13-14-22(23(16-19)30-4-2)31-17-18-9-6-5-7-10-18/h5-7,9-10,13-14,16,25H,3-4,8,11-12,15,17H2,1-2H3,(H,27,32) |
| InChIKey | OFZVBXINZPUONR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|