C25H28N2O3S — CID 110528153
4-(3-methoxy-2-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528153) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-(3-methoxy-2-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3-methoxy-2-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528153 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-(3-methoxy-2-phenylmethoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CCCN1C(=S)NC(c2cccc(OC)c2OCc2ccccc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C25H28N2O3S/c1-3-15-27-19-12-8-13-20(28)22(19)23(26-25(27)31)18-11-7-14-21(29-2)24(18)30-16-17-9-5-4-6-10-17/h4-7,9-11,14,23H,3,8,12-13,15-16H2,1-2H3,(H,26,31) |
| InChIKey | XRRITUWEHZACPD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|