C23H23N3O5S — CID 110529204
4-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110529204) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110529204 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 4-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | COc1cc(C2NC(=S)N(C)C3=C2C(=O)CCC3)cc([N+](=O)[O-])c1OCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O5S/c1-25-16-9-6-10-18(27)20(16)21(24-23(25)32)15-11-17(26(28)29)22(19(12-15)30-2)31-13-14-7-4-3-5-8-14/h3-5,7-8,11-12,21H,6,9-10,13H2,1-2H3,(H,24,32) |
| InChIKey | NIFAILJGJVXMHJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|