C22H30N2O4S — CID 110528075
4-(3,5-dimethoxy-4-propoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528075) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-(3,5-dimethoxy-4-propoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3,5-dimethoxy-4-propoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528075 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-(3,5-dimethoxy-4-propoxyphenyl)-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CCCOc1c(OC)cc(C2NC(=S)N(CCC)C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C22H30N2O4S/c1-5-10-24-15-8-7-9-16(25)19(15)20(23-22(24)29)14-12-17(26-3)21(28-11-6-2)18(13-14)27-4/h12-13,20H,5-11H2,1-4H3,(H,23,29) |
| InChIKey | QRBJVXIBBGRCIU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|