C21H26Cl2N2O2S — CID 110528193
4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528193) has the molecular formula C21H26Cl2N2O2S and a molecular weight of 441.42 g/mol. Its IUPAC name is 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528193 |
| Molecular Formula | C21H26Cl2N2O2S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1-propyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CCCN1C(=S)NC(c2cc(Cl)c(OCC(C)C)c(Cl)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C21H26Cl2N2O2S/c1-4-8-25-16-6-5-7-17(26)18(16)19(24-21(25)28)13-9-14(22)20(15(23)10-13)27-11-12(2)3/h9-10,12,19H,4-8,11H2,1-3H3,(H,24,28) |
| InChIKey | DQKMOVOAAZNINH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|