C21H27ClN2O3S — CID 110528602
4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-1-ethyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528602) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is 4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-1-ethyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-1-ethyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528602 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-1-ethyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CCOc1cc(C2NC(=S)N(CC)C3=C2C(=O)CCC3)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C21H27ClN2O3S/c1-5-24-15-8-7-9-16(25)18(15)19(23-21(24)28)13-10-14(22)20(27-12(3)4)17(11-13)26-6-2/h10-12,19H,5-9H2,1-4H3,(H,23,28) |
| InChIKey | LAWQQFYZEMHHSD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|