C17H19BrN2O3S — CID 110529074
4-(2-bromo-3,4-dimethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110529074) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 4-(2-bromo-3,4-dimethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(2-bromo-3,4-dimethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110529074 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-(2-bromo-3,4-dimethoxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | COc1ccc(C2NC(=S)N(C)C3=C2C(=O)CCC3)c(Br)c1OC |
| InChI | InChI=1S/C17H19BrN2O3S/c1-20-10-5-4-6-11(21)13(10)15(19-17(20)24)9-7-8-12(22-2)16(23-3)14(9)18/h7-8,15H,4-6H2,1-3H3,(H,19,24) |
| InChIKey | ATKCXOSUDFHMSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|