C15H14Br2N2O2S — CID 110529170
4-(3,5-dibromo-4-hydroxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110529170) has the molecular formula C15H14Br2N2O2S and a molecular weight of 446.16 g/mol. Its IUPAC name is 4-(3,5-dibromo-4-hydroxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 4-(3,5-dibromo-4-hydroxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110529170 |
| Molecular Formula | C15H14Br2N2O2S |
| Molecular Weight | 446.16 g/mol |
| Exact Mass | 443.91 |
| IUPAC Name | 4-(3,5-dibromo-4-hydroxyphenyl)-1-methyl-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | CN1C(=S)NC(c2cc(Br)c(O)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C15H14Br2N2O2S/c1-19-10-3-2-4-11(20)12(10)13(18-15(19)22)7-5-8(16)14(21)9(17)6-7/h5-6,13,21H,2-4H2,1H3,(H,18,22) |
| InChIKey | XVIHTXRCVTXIEE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|