C22H19FN2O3S — CID 110529068
[4-(1-methyl-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-4-yl)phenyl] 4-fluorobenzoate (PubChem CID 110529068) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is [4-(1-methyl-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-4-yl)phenyl] 4-fluorobenzoate.
| Compound Name | [4-(1-methyl-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-4-yl)phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110529068 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [4-(1-methyl-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-4-yl)phenyl] 4-fluorobenzoate |
| SMILES | CN1C(=S)NC(c2ccc(OC(=O)c3ccc(F)cc3)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C22H19FN2O3S/c1-25-17-3-2-4-18(26)19(17)20(24-22(25)29)13-7-11-16(12-8-13)28-21(27)14-5-9-15(23)10-6-14/h5-12,20H,2-4H2,1H3,(H,24,29) |
| InChIKey | BLFOPIXXJQDJET-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|