C23H23FN2O3S — CID 110528164
[4-(5-acetyl-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-6-yl)phenyl] 4-fluorobenzoate (PubChem CID 110528164) has the molecular formula C23H23FN2O3S and a molecular weight of 426.51 g/mol. Its IUPAC name is [4-(5-acetyl-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-6-yl)phenyl] 4-fluorobenzoate.
| Compound Name | [4-(5-acetyl-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-6-yl)phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110528164 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [4-(5-acetyl-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-6-yl)phenyl] 4-fluorobenzoate |
| SMILES | CCCN1C(=S)NC(c2ccc(OC(=O)c3ccc(F)cc3)cc2)C(C(C)=O)=C1C |
| InChI | InChI=1S/C23H23FN2O3S/c1-4-13-26-14(2)20(15(3)27)21(25-23(26)30)16-7-11-19(12-8-16)29-22(28)17-5-9-18(24)10-6-17/h5-12,21H,4,13H2,1-3H3,(H,25,30) |
| InChIKey | QMCDSKZRYQJAPT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|