C24H28N2OS — CID 110527781
[4-methyl-6-(4-propan-2-ylphenyl)-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110527781) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is [4-methyl-6-(4-propan-2-ylphenyl)-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [4-methyl-6-(4-propan-2-ylphenyl)-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110527781 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [4-methyl-6-(4-propan-2-ylphenyl)-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CCCN1C(=S)NC(c2ccc(C(C)C)cc2)C(C(=O)c2ccccc2)=C1C |
| InChI | InChI=1S/C24H28N2OS/c1-5-15-26-17(4)21(23(27)20-9-7-6-8-10-20)22(25-24(26)28)19-13-11-18(12-14-19)16(2)3/h6-14,16,22H,5,15H2,1-4H3,(H,25,28) |
| InChIKey | YHEHKALFAJIVIU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|