C20H19BrN2OS — CID 110528324
[6-(3-bromophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110528324) has the molecular formula C20H19BrN2OS and a molecular weight of 415.36 g/mol. Its IUPAC name is [6-(3-bromophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [6-(3-bromophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110528324 |
| Molecular Formula | C20H19BrN2OS |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [6-(3-bromophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CCN1C(=S)NC(c2cccc(Br)c2)C(C(=O)c2ccccc2)=C1C |
| InChI | InChI=1S/C20H19BrN2OS/c1-3-23-13(2)17(19(24)14-8-5-4-6-9-14)18(22-20(23)25)15-10-7-11-16(21)12-15/h4-12,18H,3H2,1-2H3,(H,22,25) |
| InChIKey | RYMITQCARYXYPA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|