C23H25ClN2O2S — CID 110527888
[6-(3-chloro-4-ethoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110527888) has the molecular formula C23H25ClN2O2S and a molecular weight of 428.99 g/mol. Its IUPAC name is [6-(3-chloro-4-ethoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [6-(3-chloro-4-ethoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110527888 |
| Molecular Formula | C23H25ClN2O2S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [6-(3-chloro-4-ethoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CCCN1C(=S)NC(c2ccc(OCC)c(Cl)c2)C(C(=O)c2ccccc2)=C1C |
| InChI | InChI=1S/C23H25ClN2O2S/c1-4-13-26-15(3)20(22(27)16-9-7-6-8-10-16)21(25-23(26)29)17-11-12-19(28-5-2)18(24)14-17/h6-12,14,21H,4-5,13H2,1-3H3,(H,25,29) |
| InChIKey | NKJDANDZYWIQTB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|