C25H30N2O2S — CID 110527867
[6-(2-butoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110527867) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is [6-(2-butoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [6-(2-butoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110527867 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [6-(2-butoxyphenyl)-4-methyl-3-propyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CCCCOc1ccccc1C1NC(=S)N(CCC)C(C)=C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O2S/c1-4-6-17-29-21-15-11-10-14-20(21)23-22(24(28)19-12-8-7-9-13-19)18(3)27(16-5-2)25(30)26-23/h7-15,23H,4-6,16-17H2,1-3H3,(H,26,30) |
| InChIKey | LJGYEIWEIRFDPZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|