C20H17F3N2OS — CID 110528766
[3,4-dimethyl-2-sulfanylidene-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-5-yl]-phenylmethanone (PubChem CID 110528766) has the molecular formula C20H17F3N2OS and a molecular weight of 390.43 g/mol. Its IUPAC name is [3,4-dimethyl-2-sulfanylidene-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-5-yl]-phenylmethanone.
| Compound Name | [3,4-dimethyl-2-sulfanylidene-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110528766 |
| Molecular Formula | C20H17F3N2OS |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [3,4-dimethyl-2-sulfanylidene-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-5-yl]-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2ccccc2C(F)(F)F)NC(=S)N1C |
| InChI | InChI=1S/C20H17F3N2OS/c1-12-16(18(26)13-8-4-3-5-9-13)17(24-19(27)25(12)2)14-10-6-7-11-15(14)20(21,22)23/h3-11,17H,1-2H3,(H,24,27) |
| InChIKey | OGFNVXNFAPZFFO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|