C28H27FN2O4 — CID 3499493
N-(4-fluorophenyl)-2-[4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 3499493) has the molecular formula C28H27FN2O4 and a molecular weight of 474.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 3499493 |
| Molecular Formula | C28H27FN2O4 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2ccc(OCC(=O)Nc3ccc(F)cc3)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H27FN2O4/c1-31-21-4-2-6-23(32)27(21)26(28-22(31)5-3-7-24(28)33)17-8-14-20(15-9-17)35-16-25(34)30-19-12-10-18(29)11-13-19/h8-15,26H,2-7,16H2,1H3,(H,30,34) |
| InChIKey | IGDAGJXHRKLDIG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |