C29H28Cl2N2O4 — CID 126278154
2-[4-chloro-2-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126278154) has the molecular formula C29H28Cl2N2O4 and a molecular weight of 539.46 g/mol. Its IUPAC name is 2-[4-chloro-2-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126278154 |
| Molecular Formula | C29H28Cl2N2O4 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-[4-chloro-2-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Cl)cc2C2C3=C(CCCC3=O)N(C)C3=C2C(=O)CCC3)cc1Cl |
| InChI | InChI=1S/C29H28Cl2N2O4/c1-16-9-11-18(14-20(16)31)32-26(36)15-37-25-12-10-17(30)13-19(25)27-28-21(5-3-7-23(28)34)33(2)22-6-4-8-24(35)29(22)27/h9-14,27H,3-8,15H2,1-2H3,(H,32,36) |
| InChIKey | XFLNAMSILHIESK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |