C33H36Cl2N2O4 — CID 126231587
2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126231587) has the molecular formula C33H36Cl2N2O4 and a molecular weight of 595.57 g/mol. Its IUPAC name is 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126231587 |
| Molecular Formula | C33H36Cl2N2O4 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)ccc2OCC(=O)Nc2ccc(Cl)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C33H36Cl2N2O4/c1-6-37-23-14-32(2,3)16-25(38)30(23)29(31-24(37)15-33(4,5)17-26(31)39)22-13-20(35)9-12-27(22)41-18-28(40)36-21-10-7-19(34)8-11-21/h7-13,29H,6,14-18H2,1-5H3,(H,36,40) |
| InChIKey | QAFRRPVNJDPASA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |