C35H40Cl2N2O4 — CID 126258853
N-(3-chloro-4-methylphenyl)-2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126258853) has the molecular formula C35H40Cl2N2O4 and a molecular weight of 623.62 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126258853 |
| Molecular Formula | C35H40Cl2N2O4 |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C35H40Cl2N2O4/c1-7-12-39-25-15-34(3,4)17-27(40)32(25)31(33-26(39)16-35(5,6)18-28(33)41)21-9-11-29(24(37)13-21)43-19-30(42)38-22-10-8-20(2)23(36)14-22/h8-11,13-14,31H,7,12,15-19H2,1-6H3,(H,38,42) |
| InChIKey | UOORXTAANXGXMR-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |