C30H31ClN2O4 — CID 126261749
2-[2-chloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126261749) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is 2-[2-chloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126261749 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-[2-chloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3C4=C(CCCC4=O)N(C)C4=C3C(=O)CCC4)cc2Cl)cc1C |
| InChI | InChI=1S/C30H31ClN2O4/c1-17-10-12-20(14-18(17)2)32-27(36)16-37-26-13-11-19(15-21(26)31)28-29-22(6-4-8-24(29)34)33(3)23-7-5-9-25(35)30(23)28/h10-15,28H,4-9,16H2,1-3H3,(H,32,36) |
| InChIKey | MEEHKGDQUKIZIS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |