C23H24N2O2S — CID 110528949
1-methyl-4-[2-[(2-methylphenyl)methoxy]phenyl]-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one (PubChem CID 110528949) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-methyl-4-[2-[(2-methylphenyl)methoxy]phenyl]-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one.
| Compound Name | 1-methyl-4-[2-[(2-methylphenyl)methoxy]phenyl]-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
|---|---|
| PubChem CID | 110528949 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-methyl-4-[2-[(2-methylphenyl)methoxy]phenyl]-2-sulfanylidene-4,6,7,8-tetrahydro-3H-quinazolin-5-one |
| SMILES | Cc1ccccc1COc1ccccc1C1NC(=S)N(C)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C23H24N2O2S/c1-15-8-3-4-9-16(15)14-27-20-13-6-5-10-17(20)22-21-18(11-7-12-19(21)26)25(2)23(28)24-22/h3-6,8-10,13,22H,7,11-12,14H2,1-2H3,(H,24,28) |
| InChIKey | GXCZOTQNPWGUQU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|