C29H27Br2NO5 — CID 126078364
4-[[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 126078364) has the molecular formula C29H27Br2NO5 and a molecular weight of 629.35 g/mol. Its IUPAC name is 4-[[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126078364 |
| Molecular Formula | C29H27Br2NO5 |
| Molecular Weight | 629.35 g/mol |
| Exact Mass | 627.03 |
| IUPAC Name | 4-[[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Br)cc(Br)c2OCc2ccc(C(=O)O)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H27Br2NO5/c1-2-32-21-5-3-7-23(33)26(21)25(27-22(32)6-4-8-24(27)34)19-13-18(30)14-20(31)28(19)37-15-16-9-11-17(12-10-16)29(35)36/h9-14,25H,2-8,15H2,1H3,(H,35,36) |
| InChIKey | REGWFEVLLJQXKN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.35 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |