C27H22Br2O6 — CID 126077593
4-[[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 126077593) has the molecular formula C27H22Br2O6 and a molecular weight of 602.28 g/mol. Its IUPAC name is 4-[[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126077593 |
| Molecular Formula | C27H22Br2O6 |
| Molecular Weight | 602.28 g/mol |
| Exact Mass | 599.98 |
| IUPAC Name | 4-[[2,6-dibromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | O=C1CCCC2=C1C(c1cc(Br)c(OCc3ccc(C(=O)O)cc3)c(Br)c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C27H22Br2O6/c28-17-11-16(12-18(29)26(17)34-13-14-7-9-15(10-8-14)27(32)33)23-24-19(30)3-1-5-21(24)35-22-6-2-4-20(31)25(22)23/h7-12,23H,1-6,13H2,(H,32,33) |
| InChIKey | IRDDSAGIVNXSJI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.28 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |