C30H29BrO5 — CID 126080314
9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126080314) has the molecular formula C30H29BrO5 and a molecular weight of 549.46 g/mol. Its IUPAC name is 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126080314 |
| Molecular Formula | C30H29BrO5 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H29BrO5/c1-3-6-19-15-20(16-26(34-2)30(19)35-17-18-11-13-21(31)14-12-18)27-28-22(32)7-4-9-24(28)36-25-10-5-8-23(33)29(25)27/h3,11-16,27H,1,4-10,17H2,2H3 |
| InChIKey | OGUOQMHDCCWHQQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|