C36H42O5 — CID 126076508
9-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 126076508) has the molecular formula C36H42O5 and a molecular weight of 554.73 g/mol. Its IUPAC name is 9-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126076508 |
| Molecular Formula | C36H42O5 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 9-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C36H42O5/c1-8-10-24-15-25(16-28(39-9-2)34(24)40-21-23-13-11-22(3)12-14-23)31-32-26(37)17-35(4,5)19-29(32)41-30-20-36(6,7)18-27(38)33(30)31/h8,11-16,31H,1,9-10,17-21H2,2-7H3 |
| InChIKey | ZQYIPQUGFXIOSQ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|