C40H49NO7 — CID 126076132
4-[[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126076132) has the molecular formula C40H49NO7 and a molecular weight of 655.83 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126076132 |
| Molecular Formula | C40H49NO7 |
| Molecular Weight | 655.83 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | 4-[[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C40H49NO7/c1-8-11-27-18-28(19-33(47-9-2)37(27)48-24-25-12-14-26(15-13-25)38(44)45)34-35-29(20-39(3,4)22-31(35)42)41(16-10-17-46-7)30-21-40(5,6)23-32(43)36(30)34/h8,12-15,18-19,34H,1,9-11,16-17,20-24H2,2-7H3,(H,44,45) |
| InChIKey | WHHBSMPAWQSEIP-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.83 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|