C32H41NO6 — CID 126071414
2-[9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126071414) has the molecular formula C32H41NO6 and a molecular weight of 535.68 g/mol. Its IUPAC name is 2-[9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126071414 |
| Molecular Formula | C32H41NO6 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 2-[9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCCC |
| InChI | InChI=1S/C32H41NO6/c1-8-10-19-12-20(13-25(38-7)30(19)39-11-9-2)27-28-21(14-31(3,4)16-23(28)34)33(18-26(36)37)22-15-32(5,6)17-24(35)29(22)27/h8,12-13,27H,1,9-11,14-18H2,2-7H3,(H,36,37) |
| InChIKey | GSVZPIQDUSEVDU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|