C31H39NO6 — CID 126077040
3-[9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126077040) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is 3-[9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126077040 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 3-[9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C31H39NO6/c1-8-9-18-12-19(13-24(37-6)29(18)38-7)26-27-20(14-30(2,3)16-22(27)33)32(11-10-25(35)36)21-15-31(4,5)17-23(34)28(21)26/h8,12-13,26H,1,9-11,14-17H2,2-7H3,(H,35,36) |
| InChIKey | DLYIGLWKTBSWOT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|