C30H39NO4 — CID 126081479
9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126081479) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126081479 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C30H39NO4/c1-9-11-18-12-19(13-24(34-7)28(18)35-8)25-26-20(14-29(3,4)16-22(26)32)31(10-2)21-15-30(5,6)17-23(33)27(21)25/h9,12-13,25H,1,10-11,14-17H2,2-8H3 |
| InChIKey | UPTWBURNQGSYFX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|