C36H43NO6S — CID 126081334
[4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126081334) has the molecular formula C36H43NO6S and a molecular weight of 617.81 g/mol. Its IUPAC name is [4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126081334 |
| Molecular Formula | C36H43NO6S |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H43NO6S/c1-9-11-23-16-24(17-30(42-8)34(23)43-44(40,41)25-14-12-22(3)13-15-25)31-32-26(18-35(4,5)20-28(32)38)37(10-2)27-19-36(6,7)21-29(39)33(27)31/h9,12-17,31H,1,10-11,18-21H2,2-8H3 |
| InChIKey | VVMRFKBUERXEFR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|