C32H34ClNO6S — CID 126072515
[2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate (PubChem CID 126072515) has the molecular formula C32H34ClNO6S and a molecular weight of 596.15 g/mol. Its IUPAC name is [2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126072515 |
| Molecular Formula | C32H34ClNO6S |
| Molecular Weight | 596.15 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [2-ethoxy-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(OCC)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H34ClNO6S/c1-4-9-20-18-21(19-28(39-6-3)32(20)40-41(37,38)23-16-14-22(33)15-17-23)29-30-24(10-7-12-26(30)35)34(5-2)25-11-8-13-27(36)31(25)29/h4,14-19,29H,1,5-13H2,2-3H3 |
| InChIKey | LUCWSPZOYRQYSF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.15 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|